C22H28F2N4OS — CID 69411241
1-[5-(2,4-difluorophenyl)sulfanylpentyl]-2-(2-methoxyethyl)-6,7-dimethylimidazo[4,5-c]pyridin-4-amine (PubChem CID 69411241) has the molecular formula C22H28F2N4OS and a molecular weight of 434.56 g/mol. Its IUPAC name is 1-[5-(2,4-difluorophenyl)sulfanylpentyl]-2-(2-methoxyethyl)-6,7-dimethylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[5-(2,4-difluorophenyl)sulfanylpentyl]-2-(2-methoxyethyl)-6,7-dimethylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 69411241 |
| Molecular Formula | C22H28F2N4OS |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[5-(2,4-difluorophenyl)sulfanylpentyl]-2-(2-methoxyethyl)-6,7-dimethylimidazo[4,5-c]pyridin-4-amine |
| SMILES | COCCc1nc2c(N)nc(C)c(C)c2n1CCCCCSc1ccc(F)cc1F |
| InChI | InChI=1S/C22H28F2N4OS/c1-14-15(2)26-22(25)20-21(14)28(19(27-20)9-11-29-3)10-5-4-6-12-30-18-8-7-16(23)13-17(18)24/h7-8,13H,4-6,9-12H2,1-3H3,(H2,25,26) |
| InChIKey | ZUDFHLMNQIEEMK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|