C21H26Cl2N4O3S — CID 69193937
1-[5-(2,4-dichlorophenyl)sulfonylpentyl]-2-(2-methoxyethyl)-7-methylimidazo[4,5-c]pyridin-4-amine (PubChem CID 69193937) has the molecular formula C21H26Cl2N4O3S and a molecular weight of 485.44 g/mol. Its IUPAC name is 1-[5-(2,4-dichlorophenyl)sulfonylpentyl]-2-(2-methoxyethyl)-7-methylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[5-(2,4-dichlorophenyl)sulfonylpentyl]-2-(2-methoxyethyl)-7-methylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 69193937 |
| Molecular Formula | C21H26Cl2N4O3S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 1-[5-(2,4-dichlorophenyl)sulfonylpentyl]-2-(2-methoxyethyl)-7-methylimidazo[4,5-c]pyridin-4-amine |
| SMILES | COCCc1nc2c(N)ncc(C)c2n1CCCCCS(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H26Cl2N4O3S/c1-14-13-25-21(24)19-20(14)27(18(26-19)8-10-30-2)9-4-3-5-11-31(28,29)17-7-6-15(22)12-16(17)23/h6-7,12-13H,3-5,8-11H2,1-2H3,(H2,24,25) |
| InChIKey | DLSFQRUSZKKCEL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|