C18H24N6O2S — CID 69410770
2-(2-methoxyethyl)-7-methyl-1-(4-pyrimidin-2-ylsulfinylbutyl)imidazo[4,5-c]pyridin-4-amine (PubChem CID 69410770) has the molecular formula C18H24N6O2S and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-7-methyl-1-(4-pyrimidin-2-ylsulfinylbutyl)imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 2-(2-methoxyethyl)-7-methyl-1-(4-pyrimidin-2-ylsulfinylbutyl)imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 69410770 |
| Molecular Formula | C18H24N6O2S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-(2-methoxyethyl)-7-methyl-1-(4-pyrimidin-2-ylsulfinylbutyl)imidazo[4,5-c]pyridin-4-amine |
| SMILES | COCCc1nc2c(N)ncc(C)c2n1CCCCS(=O)c1ncccn1 |
| InChI | InChI=1S/C18H24N6O2S/c1-13-12-22-17(19)15-16(13)24(14(23-15)6-10-26-2)9-3-4-11-27(25)18-20-7-5-8-21-18/h5,7-8,12H,3-4,6,9-11H2,1-2H3,(H2,19,22) |
| InChIKey | FJDPXXDUQSTOAC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|