C15H19BF4N2O5 — CID 150543297
[(1R)-1-[[2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-methylbutoxy]boronic acid (PubChem CID 150543297) has the molecular formula C15H19BF4N2O5 and a molecular weight of 394.13 g/mol. Its IUPAC name is [(1R)-1-[[2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-methylbutoxy]boronic acid.
| Compound Name | [(1R)-1-[[2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-methylbutoxy]boronic acid |
|---|---|
| PubChem CID | 150543297 |
| Molecular Formula | C15H19BF4N2O5 |
| Molecular Weight | 394.13 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [(1R)-1-[[2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-methylbutoxy]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(C(F)(F)F)ccc1F)OB(O)O |
| InChI | InChI=1S/C15H19BF4N2O5/c1-8(2)5-13(27-16(25)26)22-12(23)7-21-14(24)10-6-9(15(18,19)20)3-4-11(10)17/h3-4,6,8,13,25-26H,5,7H2,1-2H3,(H,21,24)(H,22,23)/t13-/m1/s1 |
| InChIKey | IGILLKMZUOTUDU-CYBMUJFWSA-N |
| XLogP | 1.05 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.13 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|