C19H29N3O3 — CID 150544195
4-[3-[[carbamimidoyl(2-methylpropyl)amino]methyl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 150544195) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-[3-[[carbamimidoyl(2-methylpropyl)amino]methyl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[[carbamimidoyl(2-methylpropyl)amino]methyl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 150544195 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 4-[3-[[carbamimidoyl(2-methylpropyl)amino]methyl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | [H]/N=C(\N)N(Cc1cccc(OC2CCC(C(=O)O)CC2)c1)CC(C)C |
| InChI | InChI=1S/C19H29N3O3/c1-13(2)11-22(19(20)21)12-14-4-3-5-17(10-14)25-16-8-6-15(7-9-16)18(23)24/h3-5,10,13,15-16H,6-9,11-12H2,1-2H3,(H3,20,21)(H,23,24) |
| InChIKey | IGNDTEYQCPNCQA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|