C21H21Cl2N5O — CID 150544627
1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-2,6-dichlorocyclohexa-2,4-diene-1-carboxamide (PubChem CID 150544627) has the molecular formula C21H21Cl2N5O and a molecular weight of 430.34 g/mol. Its IUPAC name is 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-2,6-dichlorocyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-2,6-dichlorocyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 150544627 |
| Molecular Formula | C21H21Cl2N5O |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-2,6-dichlorocyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1(CCCCn2cnc3c(N)nc4ccccc4c32)C(Cl)=CC=CC1Cl |
| InChI | InChI=1S/C21H21Cl2N5O/c22-15-8-5-9-16(23)21(15,20(25)29)10-3-4-11-28-12-26-17-18(28)13-6-1-2-7-14(13)27-19(17)24/h1-2,5-9,12,15H,3-4,10-11H2,(H2,24,27)(H2,25,29) |
| InChIKey | IGPLAYXQUIAHGQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|