C32H22N2 — CID 150592740
2-(4-butan-2-ylphenyl)perylene-1,7-dicarbonitrile (PubChem CID 150592740) has the molecular formula C32H22N2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)perylene-1,7-dicarbonitrile.
| Compound Name | 2-(4-butan-2-ylphenyl)perylene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 150592740 |
| Molecular Formula | C32H22N2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)perylene-1,7-dicarbonitrile |
| SMILES | CCC(C)c1ccc(-c2cc3cccc4c5c(C#N)ccc6cccc(c(c2C#N)c34)c65)cc1 |
| InChI | InChI=1S/C32H22N2/c1-3-19(2)20-10-12-21(13-11-20)27-16-23-7-5-8-25-30(23)32(28(27)18-34)26-9-4-6-22-14-15-24(17-33)31(25)29(22)26/h4-16,19H,3H2,1-2H3 |
| InChIKey | IQFBYMJQIUEKFR-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|