C15H18N2O8 — CID 15060386
dimethyl 2-[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-2,5-dihydrofuran-3-yl]-2-methylpropanedioate (PubChem CID 15060386) has the molecular formula C15H18N2O8 and a molecular weight of 354.32 g/mol. Its IUPAC name is dimethyl 2-[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-2,5-dihydrofuran-3-yl]-2-methylpropanedioate.
| Compound Name | dimethyl 2-[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-2,5-dihydrofuran-3-yl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 15060386 |
| Molecular Formula | C15H18N2O8 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | dimethyl 2-[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-2,5-dihydrofuran-3-yl]-2-methylpropanedioate |
| SMILES | COC(=O)C(C)(C(=O)OC)C1=C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C15H18N2O8/c1-15(12(20)23-2,13(21)24-3)8-6-11(25-9(8)7-18)17-5-4-10(19)16-14(17)22/h4-6,9,11,18H,7H2,1-3H3,(H,16,19,22)/t9-,11-/m1/s1 |
| InChIKey | WJFRHKMMVPSCGW-MWLCHTKSSA-N |
| XLogP | -1.29 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|