C18H34Cl2O2 — CID 150651579
1,1-dichloro-2-(2,2-diethoxyundecan-3-yl)cyclopropane (PubChem CID 150651579) has the molecular formula C18H34Cl2O2 and a molecular weight of 353.37 g/mol. Its IUPAC name is 1,1-dichloro-2-(2,2-diethoxyundecan-3-yl)cyclopropane.
| Compound Name | 1,1-dichloro-2-(2,2-diethoxyundecan-3-yl)cyclopropane |
|---|---|
| PubChem CID | 150651579 |
| Molecular Formula | C18H34Cl2O2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1,1-dichloro-2-(2,2-diethoxyundecan-3-yl)cyclopropane |
| SMILES | CCCCCCCCC(C1CC1(Cl)Cl)C(C)(OCC)OCC |
| InChI | InChI=1S/C18H34Cl2O2/c1-5-8-9-10-11-12-13-15(16-14-18(16,19)20)17(4,21-6-2)22-7-3/h15-16H,5-14H2,1-4H3 |
| InChIKey | JBZDHCXRBCXIOY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|