C17H34OSi — CID 150670949
tert-butyl-[(3S)-5-cyclopropyl-2,2-dimethylhex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 150670949) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is tert-butyl-[(3S)-5-cyclopropyl-2,2-dimethylhex-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S)-5-cyclopropyl-2,2-dimethylhex-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 150670949 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | tert-butyl-[(3S)-5-cyclopropyl-2,2-dimethylhex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C(C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C)C1CC1 |
| InChI | InChI=1S/C17H34OSi/c1-13(14-10-11-14)12-15(16(2,3)4)18-19(8,9)17(5,6)7/h14-15H,1,10-12H2,2-9H3/t15-/m0/s1 |
| InChIKey | JFWBZTTZWDZTBJ-HNNXBMFYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|