C17H36OSi — CID 178046304
tert-butyl-dimethyl-(2,2,7-trimethyloct-7-en-3-yloxy)silane (PubChem CID 178046304) has the molecular formula C17H36OSi and a molecular weight of 284.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,2,7-trimethyloct-7-en-3-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(2,2,7-trimethyloct-7-en-3-yloxy)silane |
|---|---|
| PubChem CID | 178046304 |
| Molecular Formula | C17H36OSi |
| Molecular Weight | 284.56 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | tert-butyl-dimethyl-(2,2,7-trimethyloct-7-en-3-yloxy)silane |
| SMILES | C=C(C)CCCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H36OSi/c1-14(2)12-11-13-15(16(3,4)5)18-19(9,10)17(6,7)8/h15H,1,11-13H2,2-10H3 |
| InChIKey | LUHMOKILLGKOKW-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|