C9H9ClF4N2 — CID 150808123
3-chloro-6-fluoro-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine (PubChem CID 150808123) has the molecular formula C9H9ClF4N2 and a molecular weight of 256.63 g/mol. Its IUPAC name is 3-chloro-6-fluoro-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine.
| Compound Name | 3-chloro-6-fluoro-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 150808123 |
| Molecular Formula | C9H9ClF4N2 |
| Molecular Weight | 256.63 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3-chloro-6-fluoro-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine |
| SMILES | Nc1c(Cl)ccc(F)c1NCCC(F)(F)F |
| InChI | InChI=1S/C9H9ClF4N2/c10-5-1-2-6(11)8(7(5)15)16-4-3-9(12,13)14/h1-2,16H,3-4,15H2 |
| InChIKey | KHHQHZPCUURDSX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|