C8H21Cl2N3Si — CID 150856445
1-N-(2-aminoethyl)-5-(dichloromethylsilyl)pentane-1,2-diamine (PubChem CID 150856445) has the molecular formula C8H21Cl2N3Si and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-5-(dichloromethylsilyl)pentane-1,2-diamine.
| Compound Name | 1-N-(2-aminoethyl)-5-(dichloromethylsilyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 150856445 |
| Molecular Formula | C8H21Cl2N3Si |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-N-(2-aminoethyl)-5-(dichloromethylsilyl)pentane-1,2-diamine |
| SMILES | NCCNCC(N)CCC[SiH2]C(Cl)Cl |
| InChI | InChI=1S/C8H21Cl2N3Si/c9-8(10)14-5-1-2-7(12)6-13-4-3-11/h7-8,13H,1-6,11-12,14H2 |
| InChIKey | KRCLALMRHCJUCL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|