C17H36O6Si3 — CID 15087860
methyl (1R,4S,5R)-3-oxo-1,4,5-tris(trimethylsilyloxy)cyclohexane-1-carboxylate (PubChem CID 15087860) has the molecular formula C17H36O6Si3 and a molecular weight of 420.73 g/mol. Its IUPAC name is methyl (1R,4S,5R)-3-oxo-1,4,5-tris(trimethylsilyloxy)cyclohexane-1-carboxylate.
| Compound Name | methyl (1R,4S,5R)-3-oxo-1,4,5-tris(trimethylsilyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 15087860 |
| Molecular Formula | C17H36O6Si3 |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl (1R,4S,5R)-3-oxo-1,4,5-tris(trimethylsilyloxy)cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(O[Si](C)(C)C)CC(=O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C17H36O6Si3/c1-20-16(19)17(23-26(8,9)10)11-13(18)15(22-25(5,6)7)14(12-17)21-24(2,3)4/h14-15H,11-12H2,1-10H3/t14-,15-,17+/m1/s1 |
| InChIKey | BVCDPDNAKKNGQV-INMHGKMJSA-N |
| XLogP | 3.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|