C16H18N2O4 — CID 150934378
3-amino-4-[3-(1,3-benzodioxol-5-yl)prop-2-enoyl]azepan-2-one (PubChem CID 150934378) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-amino-4-[3-(1,3-benzodioxol-5-yl)prop-2-enoyl]azepan-2-one.
| Compound Name | 3-amino-4-[3-(1,3-benzodioxol-5-yl)prop-2-enoyl]azepan-2-one |
|---|---|
| PubChem CID | 150934378 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-amino-4-[3-(1,3-benzodioxol-5-yl)prop-2-enoyl]azepan-2-one |
| SMILES | NC1C(=O)NCCCC1C(=O)C=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H18N2O4/c17-15-11(2-1-7-18-16(15)20)12(19)5-3-10-4-6-13-14(8-10)22-9-21-13/h3-6,8,11,15H,1-2,7,9,17H2,(H,18,20) |
| InChIKey | LGSBNVMXDAVMQD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|