C10H14N4O2S — CID 150957201
2-azido-N,N-diethylbenzenesulfonamide (PubChem CID 150957201) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-azido-N,N-diethylbenzenesulfonamide.
| Compound Name | 2-azido-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 150957201 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-azido-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C10H14N4O2S/c1-3-14(4-2)17(15,16)10-8-6-5-7-9(10)12-13-11/h5-8H,3-4H2,1-2H3 |
| InChIKey | LLIFIPGDMYUPPA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|