C7H12N2S2 — CID 150983894
(3S)-1-(4,5-dihydro-1,3-thiazol-2-yl)pyrrolidine-3-thiol (PubChem CID 150983894) has the molecular formula C7H12N2S2 and a molecular weight of 188.32 g/mol. Its IUPAC name is (3S)-1-(4,5-dihydro-1,3-thiazol-2-yl)pyrrolidine-3-thiol.
| Compound Name | (3S)-1-(4,5-dihydro-1,3-thiazol-2-yl)pyrrolidine-3-thiol |
|---|---|
| PubChem CID | 150983894 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (3S)-1-(4,5-dihydro-1,3-thiazol-2-yl)pyrrolidine-3-thiol |
| SMILES | S[C@H]1CCN(C2=NCCS2)C1 |
| InChI | InChI=1S/C7H12N2S2/c10-6-1-3-9(5-6)7-8-2-4-11-7/h6,10H,1-5H2/t6-/m0/s1 |
| InChIKey | LQQXVSWBIKKNFP-LURJTMIESA-N |
| XLogP | 1.09 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|