C7H12N2S — CID 12826604
2,3,5,6,7,8-hexahydro-[1,3]thiazolo[3,2-a][1,3]diazepine (PubChem CID 12826604) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydro-[1,3]thiazolo[3,2-a][1,3]diazepine.
| Compound Name | 2,3,5,6,7,8-hexahydro-[1,3]thiazolo[3,2-a][1,3]diazepine |
|---|---|
| PubChem CID | 12826604 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2,3,5,6,7,8-hexahydro-[1,3]thiazolo[3,2-a][1,3]diazepine |
| SMILES | C1CCN2CCSC2=NC1 |
| InChI | InChI=1S/C7H12N2S/c1-2-4-9-5-6-10-7(9)8-3-1/h1-6H2 |
| InChIKey | SCIAEODYCSHPNQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |