About 1-oxopropan-2-yl 2-bromooctanoate
1-oxopropan-2-yl 2-bromooctanoate (PubChem CID 15102417) has the molecular formula C11H19BrO3
and a molecular weight of 279.17 g/mol. Its IUPAC name is 1-oxopropan-2-yl 2-bromooctanoate.
Molecular Properties
| Compound Name | 1-oxopropan-2-yl 2-bromooctanoate |
| PubChem CID | 15102417 |
| Molecular Formula | C11H19BrO3 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 1-oxopropan-2-yl 2-bromooctanoate |
| SMILES | CCCCCCC(Br)C(=O)OC(C)C=O |
| InChI | InChI=1S/C11H19BrO3/c1-3-4-5-6-7-10(12)11(14)15-9(2)8-13/h8-10H,3-7H2,1-2H3 |
| InChIKey | AUNAMPOTCTTWQA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-oxopropan-2-yl 2-bromooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxopropan-2-yl 2-bromooctanoate?
The IUPAC name of 1-oxopropan-2-yl 2-bromooctanoate (CID 15102417) is 1-oxopropan-2-yl 2-bromooctanoate.
What is the SMILES notation for 1-oxopropan-2-yl 2-bromooctanoate?
The canonical SMILES for 1-oxopropan-2-yl 2-bromooctanoate is CCCCCCC(Br)C(=O)OC(C)C=O.
What is the InChIKey of 1-oxopropan-2-yl 2-bromooctanoate?
The InChIKey is AUNAMPOTCTTWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BrO3/c1-3-4-5-6-7-10(12)11(14)15-9(2)8-13/h8-10H,3-7H2,1-2H3.
What are the key properties of 1-oxopropan-2-yl 2-bromooctanoate?
1-oxopropan-2-yl 2-bromooctanoate has a molecular weight of 279.17 g/mol, XLogP of 2.85, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxopropan-2-yl 2-bromooctanoate is sourced from PubChem (CID 15102417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).