C13H19N7OSi — CID 151027941
trimethyl-[2-[[5-(2H-triazolo[4,5-d]pyrimidin-7-yl)pyrazol-1-yl]methoxy]ethyl]silane (PubChem CID 151027941) has the molecular formula C13H19N7OSi and a molecular weight of 317.43 g/mol. Its IUPAC name is trimethyl-[2-[[5-(2H-triazolo[4,5-d]pyrimidin-7-yl)pyrazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-(2H-triazolo[4,5-d]pyrimidin-7-yl)pyrazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 151027941 |
| Molecular Formula | C13H19N7OSi |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | trimethyl-[2-[[5-(2H-triazolo[4,5-d]pyrimidin-7-yl)pyrazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1nccc1-c1ncnc2n[nH]nc12 |
| InChI | InChI=1S/C13H19N7OSi/c1-22(2,3)7-6-21-9-20-10(4-5-16-20)11-12-13(15-8-14-11)18-19-17-12/h4-5,8H,6-7,9H2,1-3H3,(H,14,15,17,18,19) |
| InChIKey | LZLDKHWRTVTMLV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|