C24H48O3Si2 — CID 151041037
(2R,3E,3aS,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol (PubChem CID 151041037) has the molecular formula C24H48O3Si2 and a molecular weight of 440.82 g/mol. Its IUPAC name is (2R,3E,3aS,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol.
| Compound Name | (2R,3E,3aS,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 151041037 |
| Molecular Formula | C24H48O3Si2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | (2R,3E,3aS,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C1/[C@H](O)CC2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C24H48O3Si2/c1-22(2,3)28(8,9)26-16-14-18-20(25)17-19-21(13-12-15-24(18,19)7)27-29(10,11)23(4,5)6/h14,19-21,25H,12-13,15-17H2,1-11H3/b18-14-/t19?,20-,21+,24-/m1/s1 |
| InChIKey | MCCAFVJSCCHAOM-GFNLMXHLSA-N |
| XLogP | 6.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|