C21H27N5O4S — CID 151086922
(2R,3R,4R,5R)-5-[6-amino-6-[(1R,6R)-6-thiophen-2-ylcyclohex-3-en-1-yl]-8H-purin-9-yl]-2-(hydroxymethyl)-4-methoxyoxolan-3-ol (PubChem CID 151086922) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-[6-amino-6-[(1R,6R)-6-thiophen-2-ylcyclohex-3-en-1-yl]-8H-purin-9-yl]-2-(hydroxymethyl)-4-methoxyoxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-[6-amino-6-[(1R,6R)-6-thiophen-2-ylcyclohex-3-en-1-yl]-8H-purin-9-yl]-2-(hydroxymethyl)-4-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 151086922 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (2R,3R,4R,5R)-5-[6-amino-6-[(1R,6R)-6-thiophen-2-ylcyclohex-3-en-1-yl]-8H-purin-9-yl]-2-(hydroxymethyl)-4-methoxyoxolan-3-ol |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1CN=C2C1=NC=NC2(N)[C@@H]1CC=CC[C@H]1c1cccs1 |
| InChI | InChI=1S/C21H27N5O4S/c1-29-17-16(28)14(9-27)30-20(17)26-11-24-18-19(26)23-10-25-21(18,22)13-6-3-2-5-12(13)15-7-4-8-31-15/h2-4,7-8,10,12-14,16-17,20,27-28H,5-6,9,11,22H2,1H3/t12-,13-,14-,16-,17-,20-,21?/m1/s1 |
| InChIKey | MLHMATAQXNKOKI-NBDXKZRWSA-N |
| XLogP | 0.70 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|