C28H28FNO4 — CID 151128827
5-fluoro-3-(4-methoxyphenyl)-1-(2-phenylmethoxyethyl)-8-propoxyquinolin-4-one (PubChem CID 151128827) has the molecular formula C28H28FNO4 and a molecular weight of 461.53 g/mol. Its IUPAC name is 5-fluoro-3-(4-methoxyphenyl)-1-(2-phenylmethoxyethyl)-8-propoxyquinolin-4-one.
| Compound Name | 5-fluoro-3-(4-methoxyphenyl)-1-(2-phenylmethoxyethyl)-8-propoxyquinolin-4-one |
|---|---|
| PubChem CID | 151128827 |
| Molecular Formula | C28H28FNO4 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 5-fluoro-3-(4-methoxyphenyl)-1-(2-phenylmethoxyethyl)-8-propoxyquinolin-4-one |
| SMILES | CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(CCOCc3ccccc3)c12 |
| InChI | InChI=1S/C28H28FNO4/c1-3-16-34-25-14-13-24(29)26-27(25)30(15-17-33-19-20-7-5-4-6-8-20)18-23(28(26)31)21-9-11-22(32-2)12-10-21/h4-14,18H,3,15-17,19H2,1-2H3 |
| InChIKey | MTTPSMVQAZAAEJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|