C24H26ClFN2O4 — CID 58492561
2-chloro-N-[3-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]propyl]acetamide (PubChem CID 58492561) has the molecular formula C24H26ClFN2O4 and a molecular weight of 460.93 g/mol. Its IUPAC name is 2-chloro-N-[3-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]propyl]acetamide.
| Compound Name | 2-chloro-N-[3-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 58492561 |
| Molecular Formula | C24H26ClFN2O4 |
| Molecular Weight | 460.93 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-chloro-N-[3-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]propyl]acetamide |
| SMILES | CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(CCCNC(=O)CCl)c12 |
| InChI | InChI=1S/C24H26ClFN2O4/c1-3-13-32-20-10-9-19(26)22-23(20)28(12-4-11-27-21(29)14-25)15-18(24(22)30)16-5-7-17(31-2)8-6-16/h5-10,15H,3-4,11-14H2,1-2H3,(H,27,29) |
| InChIKey | QWFWIJKVSLDYEM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|