C24H27BrFNO2 — CID 70226869
1-(4-bromobutyl)-8-butyl-5-fluoro-3-(4-methoxyphenyl)quinolin-4-one (PubChem CID 70226869) has the molecular formula C24H27BrFNO2 and a molecular weight of 460.39 g/mol. Its IUPAC name is 1-(4-bromobutyl)-8-butyl-5-fluoro-3-(4-methoxyphenyl)quinolin-4-one.
| Compound Name | 1-(4-bromobutyl)-8-butyl-5-fluoro-3-(4-methoxyphenyl)quinolin-4-one |
|---|---|
| PubChem CID | 70226869 |
| Molecular Formula | C24H27BrFNO2 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 1-(4-bromobutyl)-8-butyl-5-fluoro-3-(4-methoxyphenyl)quinolin-4-one |
| SMILES | CCCCc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(CCCCBr)c12 |
| InChI | InChI=1S/C24H27BrFNO2/c1-3-4-7-18-10-13-21(26)22-23(18)27(15-6-5-14-25)16-20(24(22)28)17-8-11-19(29-2)12-9-17/h8-13,16H,3-7,14-15H2,1-2H3 |
| InChIKey | BWCBCYINTVAGTO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|