C19H19FNO7P — CID 58492524
[8-ethoxy-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl dihydrogen phosphate (PubChem CID 58492524) has the molecular formula C19H19FNO7P and a molecular weight of 423.33 g/mol. Its IUPAC name is [8-ethoxy-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [8-ethoxy-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 58492524 |
| Molecular Formula | C19H19FNO7P |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [8-ethoxy-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl dihydrogen phosphate |
| SMILES | CCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(COP(=O)(O)O)c12 |
| InChI | InChI=1S/C19H19FNO7P/c1-3-27-16-9-8-15(20)17-18(16)21(11-28-29(23,24)25)10-14(19(17)22)12-4-6-13(26-2)7-5-12/h4-10H,3,11H2,1-2H3,(H2,23,24,25) |
| InChIKey | WMRHJTJNOSYNQU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|