C21H19FNNa2O7P — CID 67427035
disodium;[8-(cyclopropylmethoxy)-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl phosphate (PubChem CID 67427035) has the molecular formula C21H19FNNa2O7P and a molecular weight of 493.34 g/mol. Its IUPAC name is disodium;[8-(cyclopropylmethoxy)-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl phosphate.
| Compound Name | disodium;[8-(cyclopropylmethoxy)-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 67427035 |
| Molecular Formula | C21H19FNNa2O7P |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | disodium;[8-(cyclopropylmethoxy)-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl phosphate |
| SMILES | COc1ccc(-c2cn(COP(=O)([O-])[O-])c3c(OCC4CC4)ccc(F)c3c2=O)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C21H21FNO7P.2Na/c1-28-15-6-4-14(5-7-15)16-10-23(12-30-31(25,26)27)20-18(29-11-13-2-3-13)9-8-17(22)19(20)21(16)24;;/h4-10,13H,2-3,11-12H2,1H3,(H2,25,26,27);;/q;2*+1/p-2 |
| InChIKey | PZRVNWYJKXECJB-UHFFFAOYSA-L |
| XLogP | -3.58 |
| TPSA | 112.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|