C25H27FNO4P-2 — CID 163587319
8-(cyclobutylmethoxy)-3-(4-ethylphenyl)-5-fluoro-1-[(methanidyl-methylidene-oxido-λ5-phosphanyl)oxymethyl]quinolin-4-one (PubChem CID 163587319) has the molecular formula C25H27FNO4P-2 and a molecular weight of 455.47 g/mol. Its IUPAC name is 8-(cyclobutylmethoxy)-3-(4-ethylphenyl)-5-fluoro-1-[(methanidyl-methylidene-oxido-λ5-phosphanyl)oxymethyl]quinolin-4-one.
| Compound Name | 8-(cyclobutylmethoxy)-3-(4-ethylphenyl)-5-fluoro-1-[(methanidyl-methylidene-oxido-λ5-phosphanyl)oxymethyl]quinolin-4-one |
|---|---|
| PubChem CID | 163587319 |
| Molecular Formula | C25H27FNO4P-2 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 8-(cyclobutylmethoxy)-3-(4-ethylphenyl)-5-fluoro-1-[(methanidyl-methylidene-oxido-λ5-phosphanyl)oxymethyl]quinolin-4-one |
| SMILES | C=P([CH2-])([O-])OCn1cc(-c2ccc(CC)cc2)c(=O)c2c(F)ccc(OCC3CCC3)c21 |
| InChI | InChI=1S/C25H27FNO4P/c1-4-17-8-10-19(11-9-17)20-14-27(16-31-32(2,3)29)24-22(30-15-18-6-5-7-18)13-12-21(26)23(24)25(20)28/h8-14,18H,2-7,15-16H2,1H3/q-2 |
| InChIKey | GMODXIQQKIECDL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|