C22H23FNO9P — CID 58492511
[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]methyl 2-phosphonooxyacetate (PubChem CID 58492511) has the molecular formula C22H23FNO9P and a molecular weight of 495.40 g/mol. Its IUPAC name is [5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]methyl 2-phosphonooxyacetate.
| Compound Name | [5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]methyl 2-phosphonooxyacetate |
|---|---|
| PubChem CID | 58492511 |
| Molecular Formula | C22H23FNO9P |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | [5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]methyl 2-phosphonooxyacetate |
| SMILES | CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(COC(=O)COP(=O)(O)O)c12 |
| InChI | InChI=1S/C22H23FNO9P/c1-3-10-31-18-9-8-17(23)20-21(18)24(13-32-19(25)12-33-34(27,28)29)11-16(22(20)26)14-4-6-15(30-2)7-5-14/h4-9,11H,3,10,12-13H2,1-2H3,(H2,27,28,29) |
| InChIKey | QWHBFSNVFAZBIR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|