C30H39FNO7P — CID 141387471
[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]methyl 2-ditert-butylphosphoryloxyacetate (PubChem CID 141387471) has the molecular formula C30H39FNO7P and a molecular weight of 575.61 g/mol. Its IUPAC name is [5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]methyl 2-ditert-butylphosphoryloxyacetate.
| Compound Name | [5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]methyl 2-ditert-butylphosphoryloxyacetate |
|---|---|
| PubChem CID | 141387471 |
| Molecular Formula | C30H39FNO7P |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | [5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]methyl 2-ditert-butylphosphoryloxyacetate |
| SMILES | CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(COC(=O)COP(=O)(C(C)(C)C)C(C)(C)C)c12 |
| InChI | InChI=1S/C30H39FNO7P/c1-9-16-37-24-15-14-23(31)26-27(24)32(17-22(28(26)34)20-10-12-21(36-8)13-11-20)19-38-25(33)18-39-40(35,29(2,3)4)30(5,6)7/h10-15,17H,9,16,18-19H2,1-8H3 |
| InChIKey | WKBNIVRLINRCRP-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|