C27H35FN4O4 — CID 67461733
(2S)-2,6-diamino-N-[2-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]ethyl]hexanamide (PubChem CID 67461733) has the molecular formula C27H35FN4O4 and a molecular weight of 498.60 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]ethyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]ethyl]hexanamide |
|---|---|
| PubChem CID | 67461733 |
| Molecular Formula | C27H35FN4O4 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxyquinolin-1-yl]ethyl]hexanamide |
| SMILES | CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(CCNC(=O)[C@@H](N)CCCCN)c12 |
| InChI | InChI=1S/C27H35FN4O4/c1-3-16-36-23-12-11-21(28)24-25(23)32(15-14-31-27(34)22(30)6-4-5-13-29)17-20(26(24)33)18-7-9-19(35-2)10-8-18/h7-12,17,22H,3-6,13-16,29-30H2,1-2H3,(H,31,34)/t22-/m0/s1 |
| InChIKey | HIQKARLNOWCAPZ-QFIPXVFZSA-N |
| XLogP | 3.18 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|