C27H31FN2O4 — CID 58492446
5-fluoro-3-(4-methoxyphenyl)-1-(2-oxo-3-piperidin-4-ylpropyl)-8-propoxyquinolin-4-one (PubChem CID 58492446) has the molecular formula C27H31FN2O4 and a molecular weight of 466.55 g/mol. Its IUPAC name is 5-fluoro-3-(4-methoxyphenyl)-1-(2-oxo-3-piperidin-4-ylpropyl)-8-propoxyquinolin-4-one.
| Compound Name | 5-fluoro-3-(4-methoxyphenyl)-1-(2-oxo-3-piperidin-4-ylpropyl)-8-propoxyquinolin-4-one |
|---|---|
| PubChem CID | 58492446 |
| Molecular Formula | C27H31FN2O4 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 5-fluoro-3-(4-methoxyphenyl)-1-(2-oxo-3-piperidin-4-ylpropyl)-8-propoxyquinolin-4-one |
| SMILES | CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(CC(=O)CC3CCNCC3)c12 |
| InChI | InChI=1S/C27H31FN2O4/c1-3-14-34-24-9-8-23(28)25-26(24)30(16-20(31)15-18-10-12-29-13-11-18)17-22(27(25)32)19-4-6-21(33-2)7-5-19/h4-9,17-18,29H,3,10-16H2,1-2H3 |
| InChIKey | MFXFMXDSGQBNDH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |