C63H57F3N3O13P — CID 140570251
tris[[8-(cyclopropylmethoxy)-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl] phosphate (PubChem CID 140570251) has the molecular formula C63H57F3N3O13P and a molecular weight of 1152.12 g/mol. Its IUPAC name is tris[[8-(cyclopropylmethoxy)-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl] phosphate.
| Compound Name | tris[[8-(cyclopropylmethoxy)-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl] phosphate |
|---|---|
| PubChem CID | 140570251 |
| Molecular Formula | C63H57F3N3O13P |
| Molecular Weight | 1152.12 g/mol |
| Exact Mass | 1151.36 |
| IUPAC Name | tris[[8-(cyclopropylmethoxy)-5-fluoro-3-(4-methoxyphenyl)-4-oxoquinolin-1-yl]methyl] phosphate |
| SMILES | COc1ccc(-c2cn(COP(=O)(OCn3cc(-c4ccc(OC)cc4)c(=O)c4c(F)ccc(OCC5CC5)c43)OCn3cc(-c4ccc(OC)cc4)c(=O)c4c(F)ccc(OCC5CC5)c43)c3c(OCC4CC4)ccc(F)c3c2=O)cc1 |
| InChI | InChI=1S/C63H57F3N3O13P/c1-74-43-16-10-40(11-17-43)46-28-67(58-52(77-31-37-4-5-37)25-22-49(64)55(58)61(46)70)34-80-83(73,81-35-68-29-47(41-12-18-44(75-2)19-13-41)62(71)56-50(65)23-26-53(59(56)68)78-32-38-6-7-38)82-36-69-30-48(42-14-20-45(76-3)21-15-42)63(72)57-51(66)24-27-54(60(57)69)79-33-39-8-9-39/h10-30,37-39H,4-9,31-36H2,1-3H3 |
| InChIKey | HMCORSQDZDETLA-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 166.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1152.12 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|