C25H35FN3O6P — CID 58492564
ditert-butyl [5-fluoro-3-(1-methylpyrazol-4-yl)-4-oxo-8-propoxyquinolin-1-yl]methyl phosphate (PubChem CID 58492564) has the molecular formula C25H35FN3O6P and a molecular weight of 523.54 g/mol. Its IUPAC name is ditert-butyl [5-fluoro-3-(1-methylpyrazol-4-yl)-4-oxo-8-propoxyquinolin-1-yl]methyl phosphate.
| Compound Name | ditert-butyl [5-fluoro-3-(1-methylpyrazol-4-yl)-4-oxo-8-propoxyquinolin-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 58492564 |
| Molecular Formula | C25H35FN3O6P |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | ditert-butyl [5-fluoro-3-(1-methylpyrazol-4-yl)-4-oxo-8-propoxyquinolin-1-yl]methyl phosphate |
| SMILES | CCCOc1ccc(F)c2c(=O)c(-c3cnn(C)c3)cn(COP(=O)(OC(C)(C)C)OC(C)(C)C)c12 |
| InChI | InChI=1S/C25H35FN3O6P/c1-9-12-32-20-11-10-19(26)21-22(20)29(15-18(23(21)30)17-13-27-28(8)14-17)16-33-36(31,34-24(2,3)4)35-25(5,6)7/h10-11,13-15H,9,12,16H2,1-8H3 |
| InChIKey | WAEMNKNXOBMZOX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 93.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|