C25H37FN3O6P — CID 91344744
ditert-butyl [5-fluoro-3-(2-methyl-1,5-dihydropyrazol-4-yl)-4-oxo-8-propoxyquinolin-1-yl]methyl phosphate (PubChem CID 91344744) has the molecular formula C25H37FN3O6P and a molecular weight of 525.56 g/mol. Its IUPAC name is ditert-butyl [5-fluoro-3-(2-methyl-1,5-dihydropyrazol-4-yl)-4-oxo-8-propoxyquinolin-1-yl]methyl phosphate.
| Compound Name | ditert-butyl [5-fluoro-3-(2-methyl-1,5-dihydropyrazol-4-yl)-4-oxo-8-propoxyquinolin-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 91344744 |
| Molecular Formula | C25H37FN3O6P |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | ditert-butyl [5-fluoro-3-(2-methyl-1,5-dihydropyrazol-4-yl)-4-oxo-8-propoxyquinolin-1-yl]methyl phosphate |
| SMILES | CCCOc1ccc(F)c2c(=O)c(C3=CN(C)NC3)cn(COP(=O)(OC(C)(C)C)OC(C)(C)C)c12 |
| InChI | InChI=1S/C25H37FN3O6P/c1-9-12-32-20-11-10-19(26)21-22(20)29(15-18(23(21)30)17-13-27-28(8)14-17)16-33-36(31,34-24(2,3)4)35-25(5,6)7/h10-11,14-15,27H,9,12-13,16H2,1-8H3 |
| InChIKey | XSOHZOLJPFTDGL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|