C22H26FN3O2 — CID 151129274
2-[4-(6-(18F)fluoropyrrolo[2,3-b]pyridin-1-yl)butyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 151129274) has the molecular formula C22H26FN3O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-[4-(6-(18F)fluoropyrrolo[2,3-b]pyridin-1-yl)butyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[4-(6-(18F)fluoropyrrolo[2,3-b]pyridin-1-yl)butyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 151129274 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[4-(6-(18F)fluoropyrrolo[2,3-b]pyridin-1-yl)butyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(CCCCn1ccc3ccc([18F])nc31)CC2 |
| InChI | InChI=1S/C22H26FN3O2/c1-27-19-13-17-7-11-25(15-18(17)14-20(19)28-2)9-3-4-10-26-12-8-16-5-6-21(23)24-22(16)26/h5-6,8,12-14H,3-4,7,9-11,15H2,1-2H3/i23-1 |
| InChIKey | MTVWWAOECCMNKP-VNRZBHCFSA-N |
| XLogP | 4.03 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|