C10H13ClN4O3 — CID 151218992
N-[amino-(hydroxyamino)methylidene]-3,4-dimethoxybenzenecarbohydrazonoyl chloride (PubChem CID 151218992) has the molecular formula C10H13ClN4O3 and a molecular weight of 272.69 g/mol. Its IUPAC name is N-[amino-(hydroxyamino)methylidene]-3,4-dimethoxybenzenecarbohydrazonoyl chloride.
| Compound Name | N-[amino-(hydroxyamino)methylidene]-3,4-dimethoxybenzenecarbohydrazonoyl chloride |
|---|---|
| PubChem CID | 151218992 |
| Molecular Formula | C10H13ClN4O3 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-[amino-(hydroxyamino)methylidene]-3,4-dimethoxybenzenecarbohydrazonoyl chloride |
| SMILES | COc1ccc(C(Cl)=NN=C(N)NO)cc1OC |
| InChI | InChI=1S/C10H13ClN4O3/c1-17-7-4-3-6(5-8(7)18-2)9(11)13-14-10(12)15-16/h3-5,16H,1-2H3,(H3,12,14,15) |
| InChIKey | NLWHKZVWBYNOLJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|