C18H10F3NS2 — CID 151241023
4,6-diphenyl-2-(trifluoromethyl)thieno[3,4-d][1,3]thiazole (PubChem CID 151241023) has the molecular formula C18H10F3NS2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 4,6-diphenyl-2-(trifluoromethyl)thieno[3,4-d][1,3]thiazole.
| Compound Name | 4,6-diphenyl-2-(trifluoromethyl)thieno[3,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 151241023 |
| Molecular Formula | C18H10F3NS2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 4,6-diphenyl-2-(trifluoromethyl)thieno[3,4-d][1,3]thiazole |
| SMILES | FC(F)(F)c1nc2c(-c3ccccc3)sc(-c3ccccc3)c2s1 |
| InChI | InChI=1S/C18H10F3NS2/c19-18(20,21)17-22-13-14(11-7-3-1-4-8-11)23-15(16(13)24-17)12-9-5-2-6-10-12/h1-10H |
| InChIKey | NQHSEFQIONASQQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |