About 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine
1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine (PubChem CID 151323058) has the molecular formula C19H18BrF2N
and a molecular weight of 378.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine |
| PubChem CID | 151323058 |
| Molecular Formula | C19H18BrF2N |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine |
| SMILES | FC1(F)CC(c2ccccc2C2CC2)N(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H18BrF2N/c20-14-7-9-15(10-8-14)23-12-19(21,22)11-18(23)17-4-2-1-3-16(17)13-5-6-13/h1-4,7-10,13,18H,5-6,11-12H2 |
| InChIKey | OGWFVEMQHVHVTE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine?
The IUPAC name of 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine (CID 151323058) is 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine.
What is the SMILES notation for 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine?
The canonical SMILES for 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine is FC1(F)CC(c2ccccc2C2CC2)N(c2ccc(Br)cc2)C1.
What is the InChIKey of 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine?
The InChIKey is OGWFVEMQHVHVTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18BrF2N/c20-14-7-9-15(10-8-14)23-12-19(21,22)11-18(23)17-4-2-1-3-16(17)13-5-6-13/h1-4,7-10,13,18H,5-6,11-12H2.
What are the key properties of 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine?
1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine has a molecular weight of 378.26 g/mol, XLogP of 5.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-(2-cyclopropylphenyl)-4,4-difluoropyrrolidine is sourced from PubChem (CID 151323058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).