C23H18N2O2 — CID 151340938
1-(2,2-diphenylacetyl)-3-hydrazinylidene-1H-inden-2-one (PubChem CID 151340938) has the molecular formula C23H18N2O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(2,2-diphenylacetyl)-3-hydrazinylidene-1H-inden-2-one.
| Compound Name | 1-(2,2-diphenylacetyl)-3-hydrazinylidene-1H-inden-2-one |
|---|---|
| PubChem CID | 151340938 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-(2,2-diphenylacetyl)-3-hydrazinylidene-1H-inden-2-one |
| SMILES | NN=C1C(=O)C(C(=O)C(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H18N2O2/c24-25-21-18-14-8-7-13-17(18)20(23(21)27)22(26)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19-20H,24H2 |
| InChIKey | OKLPPNGHSWZEAY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|