About silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione
silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione (PubChem CID 23618747) has the molecular formula C23H15AgClO3+
and a molecular weight of 482.69 g/mol. Its IUPAC name is silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione.
Molecular Properties
| Compound Name | silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione |
| PubChem CID | 23618747 |
| Molecular Formula | C23H15AgClO3+ |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1C(=O)C(c1ccccc1)c1ccc(Cl)cc1.[Ag+] |
| InChI | InChI=1S/C23H15ClO3.Ag/c24-16-12-10-15(11-13-16)19(14-6-2-1-3-7-14)23(27)20-21(25)17-8-4-5-9-18(17)22(20)26;/h1-13,19-20H;/q;+1 |
| InChIKey | AJKYVBWGZOQYRM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione?
The IUPAC name of silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione (CID 23618747) is silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione.
What is the SMILES notation for silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione?
The canonical SMILES for silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione is O=C1c2ccccc2C(=O)C1C(=O)C(c1ccccc1)c1ccc(Cl)cc1.[Ag+].
What is the InChIKey of silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione?
The InChIKey is AJKYVBWGZOQYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15ClO3.Ag/c24-16-12-10-15(11-13-16)19(14-6-2-1-3-7-14)23(27)20-21(25)17-8-4-5-9-18(17)22(20)26;/h1-13,19-20H;/q;+1.
What are the key properties of silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione?
silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione has a molecular weight of 482.69 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silver 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione is sourced from PubChem (CID 23618747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).