C26H20N2O2 — CID 98298847
(2R,3Z)-2-(2,2-diphenylacetyl)-3-[(Z)-prop-2-enylidenehydrazinylidene]inden-1-one (PubChem CID 98298847) has the molecular formula C26H20N2O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is (2R,3Z)-2-(2,2-diphenylacetyl)-3-[(Z)-prop-2-enylidenehydrazinylidene]inden-1-one.
| Compound Name | (2R,3Z)-2-(2,2-diphenylacetyl)-3-[(Z)-prop-2-enylidenehydrazinylidene]inden-1-one |
|---|---|
| PubChem CID | 98298847 |
| Molecular Formula | C26H20N2O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (2R,3Z)-2-(2,2-diphenylacetyl)-3-[(Z)-prop-2-enylidenehydrazinylidene]inden-1-one |
| SMILES | C=C/C=N\N=C1/c2ccccc2C(=O)[C@H]1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20N2O2/c1-2-17-27-28-24-20-15-9-10-16-21(20)25(29)23(24)26(30)22(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h2-17,22-23H,1H2/b27-17-,28-24+/t23-/m0/s1 |
| InChIKey | DZDKTKPIBKYPSR-VTFSOXIGSA-N |
| XLogP | 4.86 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|