C23H16Cl2O3 — CID 67831677
2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione;hydrochloride (PubChem CID 67831677) has the molecular formula C23H16Cl2O3 and a molecular weight of 411.28 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione;hydrochloride.
| Compound Name | 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 67831677 |
| Molecular Formula | C23H16Cl2O3 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-phenylacetyl]indene-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)C1C(=O)C(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H15ClO3.ClH/c24-16-12-10-15(11-13-16)19(14-6-2-1-3-7-14)23(27)20-21(25)17-8-4-5-9-18(17)22(20)26;/h1-13,19-20H;1H |
| InChIKey | KRBKUJIUYOIEFV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|