C16H25F3N2O — CID 151391312
[3-(10,10,10-trifluorodecyl)phenoxy]hydrazine (PubChem CID 151391312) has the molecular formula C16H25F3N2O and a molecular weight of 318.38 g/mol. Its IUPAC name is [3-(10,10,10-trifluorodecyl)phenoxy]hydrazine.
| Compound Name | [3-(10,10,10-trifluorodecyl)phenoxy]hydrazine |
|---|---|
| PubChem CID | 151391312 |
| Molecular Formula | C16H25F3N2O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [3-(10,10,10-trifluorodecyl)phenoxy]hydrazine |
| SMILES | NNOc1cccc(CCCCCCCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H25F3N2O/c17-16(18,19)12-7-5-3-1-2-4-6-9-14-10-8-11-15(13-14)22-21-20/h8,10-11,13,21H,1-7,9,12,20H2 |
| InChIKey | OUMRULMCTHEQSP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|