C13H20ClNO5 — CID 151409612
diethyl 3-(3-chloropropyl)-4-oxopyrrolidine-1,3-dicarboxylate (PubChem CID 151409612) has the molecular formula C13H20ClNO5 and a molecular weight of 305.76 g/mol. Its IUPAC name is diethyl 3-(3-chloropropyl)-4-oxopyrrolidine-1,3-dicarboxylate.
| Compound Name | diethyl 3-(3-chloropropyl)-4-oxopyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 151409612 |
| Molecular Formula | C13H20ClNO5 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | diethyl 3-(3-chloropropyl)-4-oxopyrrolidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)N1CC(=O)C(CCCCl)(C(=O)OCC)C1 |
| InChI | InChI=1S/C13H20ClNO5/c1-3-19-11(17)13(6-5-7-14)9-15(8-10(13)16)12(18)20-4-2/h3-9H2,1-2H3 |
| InChIKey | OYFOJUOSXCQYCI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|