C37H47F2N3O3 — CID 151411975
1-[(2S,3R)-1-(3,5-difluorophenyl)-4-[2-(3-ethylphenyl)propan-2-ylamino]-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 151411975) has the molecular formula C37H47F2N3O3 and a molecular weight of 619.80 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3,5-difluorophenyl)-4-[2-(3-ethylphenyl)propan-2-ylamino]-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-4-[2-(3-ethylphenyl)propan-2-ylamino]-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 151411975 |
| Molecular Formula | C37H47F2N3O3 |
| Molecular Weight | 619.80 g/mol |
| Exact Mass | 619.36 |
| IUPAC Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-4-[2-(3-ethylphenyl)propan-2-ylamino]-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | C#CC1=CC(C(N)=O)([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNC(C)(C)c2cccc(CC)c2)CC(C(=O)N(CCC)CCC)=C1 |
| InChI | InChI=1S/C37H47F2N3O3/c1-7-14-42(15-8-2)34(44)28-16-26(10-4)22-37(23-28,35(40)45)32(20-27-18-30(38)21-31(39)19-27)33(43)24-41-36(5,6)29-13-11-12-25(9-3)17-29/h4,11-13,16-19,21-22,32-33,41,43H,7-9,14-15,20,23-24H2,1-3,5-6H3,(H2,40,45)/t32-,33+,37?/m1/s1 |
| InChIKey | OYSDTMGLIXLDRR-RYNFBXJNSA-N |
| XLogP | 5.58 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.80 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|