C30H45F2N3O4 — CID 150125372
1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-propoxyethylamino)butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 150125372) has the molecular formula C30H45F2N3O4 and a molecular weight of 549.70 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-propoxyethylamino)butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-propoxyethylamino)butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 150125372 |
| Molecular Formula | C30H45F2N3O4 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-propoxyethylamino)butan-2-yl]-5-methyl-3-N,3-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCOCCNC[C@H](O)[C@@H](Cc1cc(F)cc(F)c1)C1(C(N)=O)C=C(C)C=C(C(=O)N(CCC)CCC)C1 |
| InChI | InChI=1S/C30H45F2N3O4/c1-5-9-35(10-6-2)28(37)23-13-21(4)18-30(19-23,29(33)38)26(16-22-14-24(31)17-25(32)15-22)27(36)20-34-8-12-39-11-7-3/h13-15,17-18,26-27,34,36H,5-12,16,19-20H2,1-4H3,(H2,33,38)/t26-,27+,30?/m1/s1 |
| InChIKey | FACPIRQYRYUJGY-QERCTFSXSA-N |
| XLogP | 3.90 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|