C28H41F2N3O4 — CID 154511435
1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-methoxyethylamino)butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 154511435) has the molecular formula C28H41F2N3O4 and a molecular weight of 521.65 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-methoxyethylamino)butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-methoxyethylamino)butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154511435 |
| Molecular Formula | C28H41F2N3O4 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-methoxyethylamino)butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNCCOC)C=C(C)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C28H41F2N3O4/c1-5-8-33(9-6-2)27(36)28(16-19(3)11-21(17-28)26(31)35)24(25(34)18-32-7-10-37-4)14-20-12-22(29)15-23(30)13-20/h11-13,15-16,24-25,32,34H,5-10,14,17-18H2,1-4H3,(H2,31,35)/t24-,25+,28?/m1/s1 |
| InChIKey | KARDVQKYUXJORX-CRWLQCRJSA-N |
| XLogP | 3.12 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|