C32H40F3N3O3 — CID 154511424
1-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-fluorophenyl)methylamino]-3-hydroxybutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 154511424) has the molecular formula C32H40F3N3O3 and a molecular weight of 571.68 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-fluorophenyl)methylamino]-3-hydroxybutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-fluorophenyl)methylamino]-3-hydroxybutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154511424 |
| Molecular Formula | C32H40F3N3O3 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 1-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-fluorophenyl)methylamino]-3-hydroxybutan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNCc2cccc(F)c2)C=C(C)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C32H40F3N3O3/c1-4-9-38(10-5-2)31(41)32(17-21(3)11-24(18-32)30(36)40)28(15-23-13-26(34)16-27(35)14-23)29(39)20-37-19-22-7-6-8-25(33)12-22/h6-8,11-14,16-17,28-29,37,39H,4-5,9-10,15,18-20H2,1-3H3,(H2,36,40)/t28-,29+,32?/m1/s1 |
| InChIKey | CZFANGGTNMELIW-YPHHBYMXSA-N |
| XLogP | 4.81 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |