C36H51N3O4 — CID 151112693
1-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-(4-propan-2-ylphenyl)butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 151112693) has the molecular formula C36H51N3O4 and a molecular weight of 589.82 g/mol. Its IUPAC name is 1-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-(4-propan-2-ylphenyl)butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-(4-propan-2-ylphenyl)butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 151112693 |
| Molecular Formula | C36H51N3O4 |
| Molecular Weight | 589.82 g/mol |
| Exact Mass | 589.39 |
| IUPAC Name | 1-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-(4-propan-2-ylphenyl)butan-2-yl]-5-methyl-1-N,1-N-dipropylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1([C@H](Cc2ccc(C(C)C)cc2)[C@@H](O)CNCc2cccc(OC)c2)C=C(C)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C36H51N3O4/c1-7-16-39(17-8-2)35(42)36(21-26(5)18-30(22-36)34(37)41)32(20-27-12-14-29(15-13-27)25(3)4)33(40)24-38-23-28-10-9-11-31(19-28)43-6/h9-15,18-19,21,25,32-33,38,40H,7-8,16-17,20,22-24H2,1-6H3,(H2,37,41)/t32-,33+,36?/m1/s1 |
| InChIKey | MQMBSCQTYQQIEV-BBZLWSGTSA-N |
| XLogP | 5.52 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.82 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |